Menu Close

What covalent compound is CL4?

What covalent compound is CL4?

It’s carbon tetrachloride. Carbon tetrachloride is an important nonpolar covalent compound.

What is the name of the molecular compound CL4?

Carbon tetraiodide

Names
Preferred IUPAC name Tetraiodomethane
Identifiers
CAS Number 507-25-5
3D model (JSmol) Interactive image

What is CL4 in science?

Carbon tetrachloride, also known as tetrachloromethane, is an organic compound with the chemical formula CCl4. Under standard conditions for temperature and pressure, CCl4 exists as a colourless liquid which emanates a very sweet odour.

What is CCl4 called?

Carbon tetrachloride, also known by many other names (such as tetrachloromethane, also recognised by the IUPAC, carbon tet in the cleaning industry, Halon-104 in firefighting, and Refrigerant-10 in HVACR) is an organic compound with the chemical formula CCl4.

Is cl4 a compound?

What is the chemical formula of cl4?

Identification of CL4 Chemical Compound

Chemical Formula C19H19N7O8
Molecular Weight 473.39626 g/mol
IUPAC Name N-[(2E)-3-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-en-1-yl]-2,3-dihydroxy-5-nitrobenzamide
SMILES String Nc1ncnc2n(cnc12)C4OC(C=CCNC(=O)c3cc(cc(O)c3O)[N+]([O-])=O)C(O)C4O

What is the mass of cl4?

What is the name of Cl3?

Cl3 is an anion of chlorine. We call it trichloride anion. It forms when a chloride anion (Cl–) reacts with a Cl2 molecule. Furthermore, this anion does not exist as an individual chemical species.

What is the common name for CCl4?

Carbon tetrachloride, also known by many other names (such as tetrachloromethane, also recognised by the IUPAC, carbon tet in the cleaning industry, Halon-104 in firefighting, and Refrigerant-10 in HVACR) is an organic compound with the chemical formula CCl 4.

What are the naming rules in chemistry?

14 Rules to write chemical name by IUPAC nomenclature Rule 1: Identification of principal functional group. Rule 2 : Selection of parent chain Rule 3 : Selection of parent chain from more than one possibility Rule 4 : Give the root name Rule 5 : Give the numbering Rule 6 : Numbering in case of more than one possibility

What are all the chemical compounds?

There are several different types of compounds, including binary, ionic, molecular, acids, cations, and anions. These types of compounds have different properties and different chemical makeups, but they are the categories that describe the potentially millions of different chemical compounds. Examples of Compounds:

How do you write a chemical formula?

Steps for writing a chemical formula Step 1: First, you have to decide the type of the bond. Step 2: Now, write down the symbol of the polyatomic ion or the element. Step 3: Now, if the prefix was used, you’ll have to add a subscript.