Table of Contents
- 1 Why HCl is used in staining process?
- 2 What happens when hydrochloric acid HCl is added to pure water?
- 3 When Catechu is treated with vanillin and HCl shows which Colour?
- 4 What happens when HCl is heated?
- 5 What is the Iupac name of vanillin?
- 6 What is the difference between black catechu and pale Catechu?
- 7 Does HCl burn?
- 8 What is the effect of acid on DNA?
- 9 What happens when RNA is hydrolysed at alkaline pH?
Why HCl is used in staining process?
HCL Pap reagent is a differentiation reagent used primarily in regressive staining of cytology samples according to Papanicolau. It contains very low concentration of hydrochloric acid and it enables excellent differentiation of nuclei and non-nuclear structures.
What happens when hydrochloric acid HCl is added to pure water?
If we add a strong acid or strong base to water, the pH will change dramatically. For instance, adding a strong acid such as HCl to water results in the reaction HCl + H2O → H3O+ + Cl-. The resulting large concentration of (H+) makes the solution more acidic and leads to a dramatic drop in the pH.
When Catechu is treated with vanillin and HCl does it show color?
The vanillin-HCl method can be used to estimate the proanthocyanidins content in plant cells, resulting in a red color of the test in the presence of catechin or proanthcyanidins.
When Catechu is treated with vanillin and HCl shows which Colour?
Vanillin-hydrochloric acid test: Drug shows pink or red colour with a mixture of vanillin:alcohol:dilute HCl in the ratio 1:10:10. The reaction produces phloroglucinol which along with vanillin gives pink or red colour.
What happens when HCl is heated?
・Hydrochloric acid is a non-flammable, transparent and colorless or light yellow liquid. When it has a concentration of 25% or more, it is a fuming (hydrogen chloride gas, hydrochloric acid gas) strong acid. ・When hydrochloric acid is heated, it generates a large quantity of hydrochloric acid fumes.
What happens when hydrochloric acid is added?
Addition of acid with metal gives salt and hydrogen gas. When dilute Hydrochloric acid is added to iron filings, iron(II) chloride & hydrogen gas is produced. In this reaction iron displaces hydrogen from hydrochloric acid to form iron chloride & hydrogen gas this reaction is a single displacement reaction.
What is the Iupac name of vanillin?
4-hydroxy-3-methoxybenzaldehyde
| IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde |
|---|---|
| Alternative Names | vanillin 4-Hydroxy-3-methoxybenzaldehyde Vanillaldehyde Vanillic aldehyde 2-Methoxy-4-formylphenol |
| Molecular Formula | C8H8O3 |
| Molar Mass | 152.149 g/mol |
| InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
What is the difference between black catechu and pale Catechu?
Black catechu with ferric chloride gives bluish-black color. Black catechu with vanillin or Hydrochloric acid gives red or pink color. On the other hand, Pale catechu gives the positive result for gambier fluorescein test.
What is the family of Catechu?
Legumes
Senegalia catechu/Family
Does HCl burn?
Hydrochloric acid is a clear, poisonous liquid. It is a caustic chemical and highly corrosive, which means it immediately causes severe damage to tissues, such as burning, on contact.
What is the effect of acid on DNA?
1. Effect of Acid: {pH<7} DNA Hydrolysis occurs Depurination (hydrolysis of glycosidic bonds only) at pH >3 and complete hydrolysis (also cleaving of phosphodiester bond) into components at pH<2 + heat.
How does Tris HCl buffer affect DNA adsorption?
The natural allophane, gibbsite, kaolinite and an andosol adsorbed significantly more DNA in a 0.1 M Tris-HCl buffer than in a 0.1 M NaCl solution (t-test, P<0.005). In contrast, montmorillonite adsorbed significantly less DNA in the Tris-HCl than NaCl solution (P<0.05).
What happens when RNA is hydrolysed at alkaline pH?
6. RNA RNA can be easily hydrolysed at alkali pH as it contains 2’-OH. Steps- (Figure in next slide) 1. The nucleophilic attack of OH- on 2’-OH and converts it to nucleophile which results in intramolecular displacement be 2. This results in cleavage of phosphodiester bonds.